C17H16N6O3S2 — CID 17019199
2-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 17019199) has the molecular formula C17H16N6O3S2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 2-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17019199 |
| Molecular Formula | C17H16N6O3S2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-[5-[(4-nitrophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | C=CCn1c(CC(=O)Nc2nccs2)nnc1SCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H16N6O3S2/c1-2-8-22-14(10-15(24)19-16-18-7-9-27-16)20-21-17(22)28-11-12-3-5-13(6-4-12)23(25)26/h2-7,9H,1,8,10-11H2,(H,18,19,24) |
| InChIKey | XRIINWBZLDLVFG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|