C16H13Cl2N5OS2 — CID 21378578
2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 21378578) has the molecular formula C16H13Cl2N5OS2 and a molecular weight of 426.35 g/mol. Its IUPAC name is 2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 21378578 |
| Molecular Formula | C16H13Cl2N5OS2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nccs2)nnc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N5OS2/c1-2-6-23-14(10-3-4-11(17)12(18)8-10)21-22-16(23)26-9-13(24)20-15-19-5-7-25-15/h2-5,7-8H,1,6,9H2,(H,19,20,24) |
| InChIKey | QUHUSRHWOZLYGP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|