C20H16Cl2N4O3S — CID 21378572
4-[[2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid (PubChem CID 21378572) has the molecular formula C20H16Cl2N4O3S and a molecular weight of 463.35 g/mol. Its IUPAC name is 4-[[2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 21378572 |
| Molecular Formula | C20H16Cl2N4O3S |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 4-[[2-[[5-(3,4-dichlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoic acid |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(C(=O)O)cc2)nnc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N4O3S/c1-2-9-26-18(13-5-8-15(21)16(22)10-13)24-25-20(26)30-11-17(27)23-14-6-3-12(4-7-14)19(28)29/h2-8,10H,1,9,11H2,(H,23,27)(H,28,29) |
| InChIKey | FFGKSNIFWAZFGU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|