C28H19BrCl2N6OS2 — CID 18808655
2-[(5-benzyl-8-bromo-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 18808655) has the molecular formula C28H19BrCl2N6OS2 and a molecular weight of 670.44 g/mol. Its IUPAC name is 2-[(5-benzyl-8-bromo-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[(5-benzyl-8-bromo-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 18808655 |
| Molecular Formula | C28H19BrCl2N6OS2 |
| Molecular Weight | 670.44 g/mol |
| Exact Mass | 667.96 |
| IUPAC Name | 2-[(5-benzyl-8-bromo-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-[5-[(2,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CSc1nnc2c3cc(Br)ccc3n(Cc3ccccc3)c2n1)Nc1ncc(Cc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C28H19BrCl2N6OS2/c29-18-6-9-23-21(12-18)25-26(37(23)14-16-4-2-1-3-5-16)34-28(36-35-25)39-15-24(38)33-27-32-13-20(40-27)11-17-10-19(30)7-8-22(17)31/h1-10,12-13H,11,14-15H2,(H,32,33,38) |
| InChIKey | UWEIUNBMKCQIBZ-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.44 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |