C20H15BrN2OS2 — CID 153124526
2-benzylsulfanyl-6-bromo-3-(thiophen-2-ylmethyl)quinazolin-4-one (PubChem CID 153124526) has the molecular formula C20H15BrN2OS2 and a molecular weight of 443.39 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-bromo-3-(thiophen-2-ylmethyl)quinazolin-4-one.
| Compound Name | 2-benzylsulfanyl-6-bromo-3-(thiophen-2-ylmethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 153124526 |
| Molecular Formula | C20H15BrN2OS2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 2-benzylsulfanyl-6-bromo-3-(thiophen-2-ylmethyl)quinazolin-4-one |
| SMILES | O=c1c2cc(Br)ccc2nc(SCc2ccccc2)n1Cc1cccs1 |
| InChI | InChI=1S/C20H15BrN2OS2/c21-15-8-9-18-17(11-15)19(24)23(12-16-7-4-10-25-16)20(22-18)26-13-14-5-2-1-3-6-14/h1-11H,12-13H2 |
| InChIKey | VVNMRRMSEIMYRV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |