C21H15F3N2O2S2 — CID 4526258
3-(thiophen-2-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]quinazolin-4-one (PubChem CID 4526258) has the molecular formula C21H15F3N2O2S2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 3-(thiophen-2-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(thiophen-2-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4526258 |
| Molecular Formula | C21H15F3N2O2S2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 3-(thiophen-2-ylmethyl)-2-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2ccc(OC(F)(F)F)cc2)n1Cc1cccs1 |
| InChI | InChI=1S/C21H15F3N2O2S2/c22-21(23,24)28-15-9-7-14(8-10-15)13-30-20-25-18-6-2-1-5-17(18)19(27)26(20)12-16-4-3-11-29-16/h1-11H,12-13H2 |
| InChIKey | DBKYPGOMQDFUKW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |