C21H20BrN3OS — CID 112783579
5-[6-bromo-4-oxo-3-(1-phenylethyl)quinazolin-2-yl]sulfanylpentanenitrile (PubChem CID 112783579) has the molecular formula C21H20BrN3OS and a molecular weight of 442.38 g/mol. Its IUPAC name is 5-[6-bromo-4-oxo-3-(1-phenylethyl)quinazolin-2-yl]sulfanylpentanenitrile.
| Compound Name | 5-[6-bromo-4-oxo-3-(1-phenylethyl)quinazolin-2-yl]sulfanylpentanenitrile |
|---|---|
| PubChem CID | 112783579 |
| Molecular Formula | C21H20BrN3OS |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 5-[6-bromo-4-oxo-3-(1-phenylethyl)quinazolin-2-yl]sulfanylpentanenitrile |
| SMILES | CC(c1ccccc1)n1c(SCCCCC#N)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C21H20BrN3OS/c1-15(16-8-4-2-5-9-16)25-20(26)18-14-17(22)10-11-19(18)24-21(25)27-13-7-3-6-12-23/h2,4-5,8-11,14-15H,3,6-7,13H2,1H3 |
| InChIKey | YCKULQNHYKGFNK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|