C16H12BrN3O3S — CID 44590762
2-(3-amino-6-bromo-4-oxoquinazolin-2-yl)sulfanyl-2-phenylacetic acid (PubChem CID 44590762) has the molecular formula C16H12BrN3O3S and a molecular weight of 406.26 g/mol. Its IUPAC name is 2-(3-amino-6-bromo-4-oxoquinazolin-2-yl)sulfanyl-2-phenylacetic acid.
| Compound Name | 2-(3-amino-6-bromo-4-oxoquinazolin-2-yl)sulfanyl-2-phenylacetic acid |
|---|---|
| PubChem CID | 44590762 |
| Molecular Formula | C16H12BrN3O3S |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 2-(3-amino-6-bromo-4-oxoquinazolin-2-yl)sulfanyl-2-phenylacetic acid |
| SMILES | Nn1c(SC(C(=O)O)c2ccccc2)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C16H12BrN3O3S/c17-10-6-7-12-11(8-10)14(21)20(18)16(19-12)24-13(15(22)23)9-4-2-1-3-5-9/h1-8,13H,18H2,(H,22,23) |
| InChIKey | PFGXJDTYIGQGBP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |