C16H14BrN3OS — CID 53490231
3-amino-6-bromo-2-[(2-methylphenyl)methylsulfanyl]quinazolin-4-one (PubChem CID 53490231) has the molecular formula C16H14BrN3OS and a molecular weight of 376.28 g/mol. Its IUPAC name is 3-amino-6-bromo-2-[(2-methylphenyl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-amino-6-bromo-2-[(2-methylphenyl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 53490231 |
| Molecular Formula | C16H14BrN3OS |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 3-amino-6-bromo-2-[(2-methylphenyl)methylsulfanyl]quinazolin-4-one |
| SMILES | Cc1ccccc1CSc1nc2ccc(Br)cc2c(=O)n1N |
| InChI | InChI=1S/C16H14BrN3OS/c1-10-4-2-3-5-11(10)9-22-16-19-14-7-6-12(17)8-13(14)15(21)20(16)18/h2-8H,9,18H2,1H3 |
| InChIKey | HHLJWFMRJLGXLY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |