C21H23N3O4S — CID 55988792
methyl 3-(3-methoxypropyl)-4-oxo-2-(1-pyridin-3-ylethylsulfanyl)quinazoline-7-carboxylate (PubChem CID 55988792) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is methyl 3-(3-methoxypropyl)-4-oxo-2-(1-pyridin-3-ylethylsulfanyl)quinazoline-7-carboxylate.
| Compound Name | methyl 3-(3-methoxypropyl)-4-oxo-2-(1-pyridin-3-ylethylsulfanyl)quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 55988792 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | methyl 3-(3-methoxypropyl)-4-oxo-2-(1-pyridin-3-ylethylsulfanyl)quinazoline-7-carboxylate |
| SMILES | COCCCn1c(SC(C)c2cccnc2)nc2cc(C(=O)OC)ccc2c1=O |
| InChI | InChI=1S/C21H23N3O4S/c1-14(16-6-4-9-22-13-16)29-21-23-18-12-15(20(26)28-3)7-8-17(18)19(25)24(21)10-5-11-27-2/h4,6-9,12-14H,5,10-11H2,1-3H3 |
| InChIKey | OLOCKCSIWWONMK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|