C27H34N2O5S — CID 75358082
methyl 2-[1-(1-adamantyl)-1-oxopropan-2-yl]sulfanyl-3-(3-methoxypropyl)-4-oxoquinazoline-7-carboxylate (PubChem CID 75358082) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is methyl 2-[1-(1-adamantyl)-1-oxopropan-2-yl]sulfanyl-3-(3-methoxypropyl)-4-oxoquinazoline-7-carboxylate.
| Compound Name | methyl 2-[1-(1-adamantyl)-1-oxopropan-2-yl]sulfanyl-3-(3-methoxypropyl)-4-oxoquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 75358082 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | methyl 2-[1-(1-adamantyl)-1-oxopropan-2-yl]sulfanyl-3-(3-methoxypropyl)-4-oxoquinazoline-7-carboxylate |
| SMILES | COCCCn1c(SC(C)C(=O)C23CC4CC(CC(C4)C2)C3)nc2cc(C(=O)OC)ccc2c1=O |
| InChI | InChI=1S/C27H34N2O5S/c1-16(23(30)27-13-17-9-18(14-27)11-19(10-17)15-27)35-26-28-22-12-20(25(32)34-3)5-6-21(22)24(31)29(26)7-4-8-33-2/h5-6,12,16-19H,4,7-11,13-15H2,1-3H3 |
| InChIKey | ZMHBFXNBAHITDZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|