C22H31ClN2O3+2 — CID 9255982
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]azanium (PubChem CID 9255982) has the molecular formula C22H31ClN2O3+2 and a molecular weight of 406.95 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]azanium.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]azanium |
|---|---|
| PubChem CID | 9255982 |
| Molecular Formula | C22H31ClN2O3+2 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+]CC3([NH+]4CCOCC4)CCCCC3)c2cc1Cl |
| InChI | InChI=1S/C22H29ClN2O3/c1-16-11-20-18(13-19(16)23)17(12-21(26)28-20)14-24-15-22(5-3-2-4-6-22)25-7-9-27-10-8-25/h11-13,24H,2-10,14-15H2,1H3/p+2 |
| InChIKey | XRVCUEYBUHVSPR-UHFFFAOYSA-P |
| XLogP | 1.44 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|