C11H6BrClF3NOS — CID 55733622
1-[(5-bromothiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)pyridin-2-one (PubChem CID 55733622) has the molecular formula C11H6BrClF3NOS and a molecular weight of 372.59 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 55733622 |
| Molecular Formula | C11H6BrClF3NOS |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 370.90 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-chloro-5-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1c(Cl)cc(C(F)(F)F)cn1Cc1ccc(Br)s1 |
| InChI | InChI=1S/C11H6BrClF3NOS/c12-9-2-1-7(19-9)5-17-4-6(11(14,15)16)3-8(13)10(17)18/h1-4H,5H2 |
| InChIKey | HFNRZWMERZDUCG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |