C9H7ClF3NO2 — CID 8894290
3-chloro-1-(2-oxopropyl)-5-(trifluoromethyl)pyridin-2-one (PubChem CID 8894290) has the molecular formula C9H7ClF3NO2 and a molecular weight of 253.61 g/mol. Its IUPAC name is 3-chloro-1-(2-oxopropyl)-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 3-chloro-1-(2-oxopropyl)-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 8894290 |
| Molecular Formula | C9H7ClF3NO2 |
| Molecular Weight | 253.61 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 3-chloro-1-(2-oxopropyl)-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(=O)Cn1cc(C(F)(F)F)cc(Cl)c1=O |
| InChI | InChI=1S/C9H7ClF3NO2/c1-5(15)3-14-4-6(9(11,12)13)2-7(10)8(14)16/h2,4H,3H2,1H3 |
| InChIKey | HVVWUPYICWXBBR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.61 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |