C21H17BrN2O4 — CID 4019911
5-(2-bromophenyl)-5-methyl-3-[(7-methyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 4019911) has the molecular formula C21H17BrN2O4 and a molecular weight of 441.28 g/mol. Its IUPAC name is 5-(2-bromophenyl)-5-methyl-3-[(7-methyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2-bromophenyl)-5-methyl-3-[(7-methyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4019911 |
| Molecular Formula | C21H17BrN2O4 |
| Molecular Weight | 441.28 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 5-(2-bromophenyl)-5-methyl-3-[(7-methyl-2-oxochromen-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc2c(CN3C(=O)NC(C)(c4ccccc4Br)C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H17BrN2O4/c1-12-7-8-14-13(10-18(25)28-17(14)9-12)11-24-19(26)21(2,23-20(24)27)15-5-3-4-6-16(15)22/h3-10H,11H2,1-2H3,(H,23,27) |
| InChIKey | QMDHIZXWCFVRDH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|