C26H21N3O5 — CID 42972075
N-[4-[(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)methyl]-2-oxochromen-7-yl]acetamide (PubChem CID 42972075) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is N-[4-[(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)methyl]-2-oxochromen-7-yl]acetamide.
| Compound Name | N-[4-[(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)methyl]-2-oxochromen-7-yl]acetamide |
|---|---|
| PubChem CID | 42972075 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[4-[(4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl)methyl]-2-oxochromen-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(CN3C(=O)NC(C)(c4cccc5ccccc45)C3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C26H21N3O5/c1-15(30)27-18-10-11-20-17(12-23(31)34-22(20)13-18)14-29-24(32)26(2,28-25(29)33)21-9-5-7-16-6-3-4-8-19(16)21/h3-13H,14H2,1-2H3,(H,27,30)(H,28,33) |
| InChIKey | JDHQWTATDIUBGY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|