About 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride
1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride (PubChem CID 120899791) has the molecular formula C13H28ClN3
and a molecular weight of 261.84 g/mol. Its IUPAC name is 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride.
Molecular Properties
| Compound Name | 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride |
| PubChem CID | 120899791 |
| Molecular Formula | C13H28ClN3 |
| Molecular Weight | 261.84 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride |
| SMILES | CC1CCN(C)CCN1CC1(C)CCNC1.Cl |
| InChI | InChI=1S/C13H27N3.ClH/c1-12-4-7-15(3)8-9-16(12)11-13(2)5-6-14-10-13;/h12,14H,4-11H2,1-3H3;1H |
| InChIKey | FHKADWBZNNBUBP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.84 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride?
The IUPAC name of 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride (CID 120899791) is 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride.
What is the SMILES notation for 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride?
The canonical SMILES for 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride is CC1CCN(C)CCN1CC1(C)CCNC1.Cl.
What is the InChIKey of 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride?
The InChIKey is FHKADWBZNNBUBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3.ClH/c1-12-4-7-15(3)8-9-16(12)11-13(2)5-6-14-10-13;/h12,14H,4-11H2,1-3H3;1H.
What are the key properties of 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride?
1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride has a molecular weight of 261.84 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-4-[(3-methylpyrrolidin-3-yl)methyl]-1,4-diazepane;hydrochloride is sourced from PubChem (CID 120899791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).