C13H26ClN3 — CID 120903554
(3aR,6aS)-2-methyl-5-[(3-methylpyrrolidin-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120903554) has the molecular formula C13H26ClN3 and a molecular weight of 259.82 g/mol. Its IUPAC name is (3aR,6aS)-2-methyl-5-[(3-methylpyrrolidin-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-2-methyl-5-[(3-methylpyrrolidin-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120903554 |
| Molecular Formula | C13H26ClN3 |
| Molecular Weight | 259.82 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | (3aR,6aS)-2-methyl-5-[(3-methylpyrrolidin-3-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | CN1C[C@@H]2CN(CC3(C)CCNC3)C[C@@H]2C1.Cl |
| InChI | InChI=1S/C13H25N3.ClH/c1-13(3-4-14-9-13)10-16-7-11-5-15(2)6-12(11)8-16;/h11-12,14H,3-10H2,1-2H3;1H/t11-,12+,13?; |
| InChIKey | VFXQYXIHPCGTFN-KOQCZNHOSA-N |
| XLogP | 0.90 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.82 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |