C11H24ClN3 — CID 131086147
[1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 131086147) has the molecular formula C11H24ClN3 and a molecular weight of 233.79 g/mol. Its IUPAC name is [1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 131086147 |
| Molecular Formula | C11H24ClN3 |
| Molecular Weight | 233.79 g/mol |
| Exact Mass | 233.17 |
| IUPAC Name | [1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1(CN2CCC(CN)C2)CCNC1.Cl |
| InChI | InChI=1S/C11H23N3.ClH/c1-11(3-4-13-8-11)9-14-5-2-10(6-12)7-14;/h10,13H,2-9,12H2,1H3;1H |
| InChIKey | HHYZYQNCBWEJKE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.79 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |