C13H26N2O — CID 120901494
3-(ethoxymethyl)-1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidine (PubChem CID 120901494) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-(ethoxymethyl)-1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidine.
| Compound Name | 3-(ethoxymethyl)-1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 120901494 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 3-(ethoxymethyl)-1-[(3-methylpyrrolidin-3-yl)methyl]pyrrolidine |
| SMILES | CCOCC1CCN(CC2(C)CCNC2)C1 |
| InChI | InChI=1S/C13H26N2O/c1-3-16-9-12-4-7-15(8-12)11-13(2)5-6-14-10-13/h12,14H,3-11H2,1-2H3 |
| InChIKey | PNRVUJZZESORPO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |