C15H29ClN2O2 — CID 120904715
2-(cyclopropylmethoxymethyl)-4-[(3-methylpyrrolidin-3-yl)methyl]morpholine;hydrochloride (PubChem CID 120904715) has the molecular formula C15H29ClN2O2 and a molecular weight of 304.86 g/mol. Its IUPAC name is 2-(cyclopropylmethoxymethyl)-4-[(3-methylpyrrolidin-3-yl)methyl]morpholine;hydrochloride.
| Compound Name | 2-(cyclopropylmethoxymethyl)-4-[(3-methylpyrrolidin-3-yl)methyl]morpholine;hydrochloride |
|---|---|
| PubChem CID | 120904715 |
| Molecular Formula | C15H29ClN2O2 |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-(cyclopropylmethoxymethyl)-4-[(3-methylpyrrolidin-3-yl)methyl]morpholine;hydrochloride |
| SMILES | CC1(CN2CCOC(COCC3CC3)C2)CCNC1.Cl |
| InChI | InChI=1S/C15H28N2O2.ClH/c1-15(4-5-16-11-15)12-17-6-7-19-14(8-17)10-18-9-13-2-3-13;/h13-14,16H,2-12H2,1H3;1H |
| InChIKey | ICPIRJSMDJHSJM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |