C17H32ClN3 — CID 120901813
1-cyclopropyl-6-[(3-methylpyrrolidin-3-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine;hydrochloride (PubChem CID 120901813) has the molecular formula C17H32ClN3 and a molecular weight of 313.92 g/mol. Its IUPAC name is 1-cyclopropyl-6-[(3-methylpyrrolidin-3-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine;hydrochloride.
| Compound Name | 1-cyclopropyl-6-[(3-methylpyrrolidin-3-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 120901813 |
| Molecular Formula | C17H32ClN3 |
| Molecular Weight | 313.92 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 1-cyclopropyl-6-[(3-methylpyrrolidin-3-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine;hydrochloride |
| SMILES | CC1(CN2CCC3C(CCCN3C3CC3)C2)CCNC1.Cl |
| InChI | InChI=1S/C17H31N3.ClH/c1-17(7-8-18-12-17)13-19-10-6-16-14(11-19)3-2-9-20(16)15-4-5-15;/h14-16,18H,2-13H2,1H3;1H |
| InChIKey | BXQPHCFMSBVFOC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.92 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |