C12H19ClN4O2S — CID 124853404
5-chloro-N-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]pyrimidine-2-sulfonamide (PubChem CID 124853404) has the molecular formula C12H19ClN4O2S and a molecular weight of 318.83 g/mol. Its IUPAC name is 5-chloro-N-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]pyrimidine-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]pyrimidine-2-sulfonamide |
|---|---|
| PubChem CID | 124853404 |
| Molecular Formula | C12H19ClN4O2S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 5-chloro-N-[2-[(2S)-2-methylpiperidin-1-yl]ethyl]pyrimidine-2-sulfonamide |
| SMILES | C[C@H]1CCCCN1CCNS(=O)(=O)c1ncc(Cl)cn1 |
| InChI | InChI=1S/C12H19ClN4O2S/c1-10-4-2-3-6-17(10)7-5-16-20(18,19)12-14-8-11(13)9-15-12/h8-10,16H,2-7H2,1H3/t10-/m0/s1 |
| InChIKey | VUJIPCKNBLUVSP-JTQLQIEISA-N |
| XLogP | 1.28 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |