C15H19N3O4S2 — CID 110397722
N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]thiophene-2-sulfonamide (PubChem CID 110397722) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110397722 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]thiophene-2-sulfonamide |
| SMILES | O=C(c1ccco1)N1CCN(CCNS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C15H19N3O4S2/c19-15(13-3-1-11-22-13)18-9-7-17(8-10-18)6-5-16-24(20,21)14-4-2-12-23-14/h1-4,11-12,16H,5-10H2 |
| InChIKey | XULDHTWTACNJLY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |