C18H22FN3O4S — CID 110397721
4-fluoro-N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-2-methylbenzenesulfonamide (PubChem CID 110397721) has the molecular formula C18H22FN3O4S and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-fluoro-N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-2-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110397721 |
| Molecular Formula | C18H22FN3O4S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 4-fluoro-N-[2-[4-(furan-2-carbonyl)piperazin-1-yl]ethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCCN1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H22FN3O4S/c1-14-13-15(19)4-5-17(14)27(24,25)20-6-7-21-8-10-22(11-9-21)18(23)16-3-2-12-26-16/h2-5,12-13,20H,6-11H2,1H3 |
| InChIKey | LTSHXDLMFBVZOD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |