C19H23N3O5S2 — CID 3243073
1-(2-Furoyl)-4-{[1-(thien-2-ylsulfonyl)piperidin-4-yl]carbonyl}piperazine (PubChem CID 3243073) has the molecular formula C19H23N3O5S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is [4-(furan-2-carbonyl)piperazin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone.
| Compound Name | 1-(2-Furoyl)-4-{[1-(thien-2-ylsulfonyl)piperidin-4-yl]carbonyl}piperazine |
|---|---|
| PubChem CID | 3243073 |
| Molecular Formula | C19H23N3O5S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | [4-(furan-2-carbonyl)piperazin-1-yl]-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone |
| SMILES | C1CN(CCC1C(=O)N2CCN(CC2)C(=O)C3=CC=CO3)S(=O)(=O)C4=CC=CS4 |
| InChI | InChI=1S/C19H23N3O5S2/c23-18(20-9-11-21(12-10-20)19(24)16-3-1-13-27-16)15-5-7-22(8-6-15)29(25,26)17-4-2-14-28-17/h1-4,13-15H,5-12H2 |
| InChIKey | MDFADVWUTUMJKT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 128.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | 710 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |