C19H24N4O3S2 — CID 9111433
(4-pyridin-2-ylpiperazin-1-yl)-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone (PubChem CID 9111433) has the molecular formula C19H24N4O3S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is (4-pyridin-2-ylpiperazin-1-yl)-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone.
| Compound Name | (4-pyridin-2-ylpiperazin-1-yl)-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 9111433 |
| Molecular Formula | C19H24N4O3S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (4-pyridin-2-ylpiperazin-1-yl)-(1-thiophen-2-ylsulfonylpiperidin-4-yl)methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2cccs2)CC1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H24N4O3S2/c24-19(22-13-11-21(12-14-22)17-4-1-2-8-20-17)16-6-9-23(10-7-16)28(25,26)18-5-3-15-27-18/h1-5,8,15-16H,6-7,9-14H2 |
| InChIKey | NPPUWWXKGQYKAU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |