C21H17F2N3O2S — CID 42962607
N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-fluorobenzenesulfonamide (PubChem CID 42962607) has the molecular formula C21H17F2N3O2S and a molecular weight of 413.45 g/mol. Its IUPAC name is N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 42962607 |
| Molecular Formula | C21H17F2N3O2S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC(Cn1cnc2ccccc21)c1ccc(F)cc1)c1ccccc1F |
| InChI | InChI=1S/C21H17F2N3O2S/c22-16-11-9-15(10-12-16)19(13-26-14-24-18-6-2-3-7-20(18)26)25-29(27,28)21-8-4-1-5-17(21)23/h1-12,14,19,25H,13H2 |
| InChIKey | LUHJDSADWSBCFR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |