C20H20F4N4O2 — CID 78889623
1-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea (PubChem CID 78889623) has the molecular formula C20H20F4N4O2 and a molecular weight of 424.40 g/mol. Its IUPAC name is 1-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea.
| Compound Name | 1-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
|---|---|
| PubChem CID | 78889623 |
| Molecular Formula | C20H20F4N4O2 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
| SMILES | O=C(NCCOCC(F)(F)F)NC(Cn1cnc2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20F4N4O2/c21-15-7-5-14(6-8-15)17(11-28-13-26-16-3-1-2-4-18(16)28)27-19(29)25-9-10-30-12-20(22,23)24/h1-8,13,17H,9-12H2,(H2,25,27,29) |
| InChIKey | DPDDYMBMCFKKFR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|