C23H21FN4O2 — CID 55806426
1-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-3-(4-methoxyphenyl)urea (PubChem CID 55806426) has the molecular formula C23H21FN4O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is 1-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 55806426 |
| Molecular Formula | C23H21FN4O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-3-(4-methoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC(Cn2cnc3ccccc32)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H21FN4O2/c1-30-19-12-10-18(11-13-19)26-23(29)27-21(16-6-8-17(24)9-7-16)14-28-15-25-20-4-2-3-5-22(20)28/h2-13,15,21H,14H2,1H3,(H2,26,27,29) |
| InChIKey | DSFVRTDPPNLRQA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |