C26H26FN3O3 — CID 55795884
N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-[(3-methoxyphenyl)methoxy]propanamide (PubChem CID 55795884) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-[(3-methoxyphenyl)methoxy]propanamide.
| Compound Name | N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-[(3-methoxyphenyl)methoxy]propanamide |
|---|---|
| PubChem CID | 55795884 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-[(3-methoxyphenyl)methoxy]propanamide |
| SMILES | COc1cccc(COC(C)C(=O)NC(Cn2cnc3ccccc32)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H26FN3O3/c1-18(33-16-19-6-5-7-22(14-19)32-2)26(31)29-24(20-10-12-21(27)13-11-20)15-30-17-28-23-8-3-4-9-25(23)30/h3-14,17-18,24H,15-16H2,1-2H3,(H,29,31) |
| InChIKey | YUFMCNSIOFBKAM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |