C20H23FN4O — CID 119851641
N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-methyl-3-(methylamino)propanamide (PubChem CID 119851641) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 119851641 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[2-(benzimidazol-1-yl)-1-(4-fluorophenyl)ethyl]-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)NC(Cn1cnc2ccccc21)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN4O/c1-14(11-22-2)20(26)24-18(15-7-9-16(21)10-8-15)12-25-13-23-17-5-3-4-6-19(17)25/h3-10,13-14,18,22H,11-12H2,1-2H3,(H,24,26) |
| InChIKey | MBRFEAXISPIXJS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |