C23H34N4O4S2 — CID 53106175
N-[3-(azepan-1-yl)propyl]-1-[(3-methyl-2-oxo-1,3-benzothiazol-6-yl)sulfonyl]piperidine-4-carboxamide (PubChem CID 53106175) has the molecular formula C23H34N4O4S2 and a molecular weight of 494.68 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-1-[(3-methyl-2-oxo-1,3-benzothiazol-6-yl)sulfonyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-1-[(3-methyl-2-oxo-1,3-benzothiazol-6-yl)sulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 53106175 |
| Molecular Formula | C23H34N4O4S2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-1-[(3-methyl-2-oxo-1,3-benzothiazol-6-yl)sulfonyl]piperidine-4-carboxamide |
| SMILES | Cn1c(=O)sc2cc(S(=O)(=O)N3CCC(C(=O)NCCCN4CCCCCC4)CC3)ccc21 |
| InChI | InChI=1S/C23H34N4O4S2/c1-25-20-8-7-19(17-21(20)32-23(25)29)33(30,31)27-15-9-18(10-16-27)22(28)24-11-6-14-26-12-4-2-3-5-13-26/h7-8,17-18H,2-6,9-16H2,1H3,(H,24,28) |
| InChIKey | CKVXTPOAWRXSTI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|