C20H30ClN3O3S2 — CID 46387623
2-chloro-N-[2-[cyclohexyl(methyl)amino]ethyl]-5-thiomorpholin-4-ylsulfonylbenzamide (PubChem CID 46387623) has the molecular formula C20H30ClN3O3S2 and a molecular weight of 460.07 g/mol. Its IUPAC name is 2-chloro-N-[2-[cyclohexyl(methyl)amino]ethyl]-5-thiomorpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-[cyclohexyl(methyl)amino]ethyl]-5-thiomorpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46387623 |
| Molecular Formula | C20H30ClN3O3S2 |
| Molecular Weight | 460.07 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-chloro-N-[2-[cyclohexyl(methyl)amino]ethyl]-5-thiomorpholin-4-ylsulfonylbenzamide |
| SMILES | CN(CCNC(=O)c1cc(S(=O)(=O)N2CCSCC2)ccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C20H30ClN3O3S2/c1-23(16-5-3-2-4-6-16)10-9-22-20(25)18-15-17(7-8-19(18)21)29(26,27)24-11-13-28-14-12-24/h7-8,15-16H,2-6,9-14H2,1H3,(H,22,25) |
| InChIKey | AKLUJQMQBOGEBR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.07 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |