C16H17ClN2O4S2 — CID 46387560
2-chloro-N-(furan-2-ylmethyl)-5-thiomorpholin-4-ylsulfonylbenzamide (PubChem CID 46387560) has the molecular formula C16H17ClN2O4S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is 2-chloro-N-(furan-2-ylmethyl)-5-thiomorpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(furan-2-ylmethyl)-5-thiomorpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46387560 |
| Molecular Formula | C16H17ClN2O4S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-chloro-N-(furan-2-ylmethyl)-5-thiomorpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCc1ccco1)c1cc(S(=O)(=O)N2CCSCC2)ccc1Cl |
| InChI | InChI=1S/C16H17ClN2O4S2/c17-15-4-3-13(25(21,22)19-5-8-24-9-6-19)10-14(15)16(20)18-11-12-2-1-7-23-12/h1-4,7,10H,5-6,8-9,11H2,(H,18,20) |
| InChIKey | NYYZBVDFFVQIBD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |