C22H26ClN3O4S2 — CID 46387596
(2-chloro-5-thiomorpholin-4-ylsulfonylphenyl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 46387596) has the molecular formula C22H26ClN3O4S2 and a molecular weight of 496.05 g/mol. Its IUPAC name is (2-chloro-5-thiomorpholin-4-ylsulfonylphenyl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (2-chloro-5-thiomorpholin-4-ylsulfonylphenyl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46387596 |
| Molecular Formula | C22H26ClN3O4S2 |
| Molecular Weight | 496.05 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | (2-chloro-5-thiomorpholin-4-ylsulfonylphenyl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3cc(S(=O)(=O)N4CCSCC4)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H26ClN3O4S2/c1-30-18-4-2-17(3-5-18)24-8-10-25(11-9-24)22(27)20-16-19(6-7-21(20)23)32(28,29)26-12-14-31-15-13-26/h2-7,16H,8-15H2,1H3 |
| InChIKey | FTBVODPVAQUNJW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.05 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|