C24H31N3O6S — CID 55918278
(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone (PubChem CID 55918278) has the molecular formula C24H31N3O6S and a molecular weight of 489.59 g/mol. Its IUPAC name is (2-methoxy-5-morpholin-4-ylsulfonylphenyl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (2-methoxy-5-morpholin-4-ylsulfonylphenyl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 55918278 |
| Molecular Formula | C24H31N3O6S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (2-methoxy-5-morpholin-4-ylsulfonylphenyl)-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]methanone |
| SMILES | COc1ccc(N2CCCN(C(=O)c3cc(S(=O)(=O)N4CCOCC4)ccc3OC)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O6S/c1-31-20-6-4-19(5-7-20)25-10-3-11-26(13-12-25)24(28)22-18-21(8-9-23(22)32-2)34(29,30)27-14-16-33-17-15-27/h4-9,18H,3,10-17H2,1-2H3 |
| InChIKey | SAUBPSWNPYYKPC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|