C7H7N5OS — CID 65215949
N-(1H-pyrazol-4-ylmethyl)thiadiazole-4-carboxamide (PubChem CID 65215949) has the molecular formula C7H7N5OS and a molecular weight of 209.23 g/mol. Its IUPAC name is N-(1H-pyrazol-4-ylmethyl)thiadiazole-4-carboxamide.
| Compound Name | N-(1H-pyrazol-4-ylmethyl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65215949 |
| Molecular Formula | C7H7N5OS |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | N-(1H-pyrazol-4-ylmethyl)thiadiazole-4-carboxamide |
| SMILES | O=C(NCc1cn[nH]c1)c1csnn1 |
| InChI | InChI=1S/C7H7N5OS/c13-7(6-4-14-12-11-6)8-1-5-2-9-10-3-5/h2-4H,1H2,(H,8,13)(H,9,10) |
| InChIKey | GDDVXBJAELSQKQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |