C18H21F3N4OS — CID 55508324
2-(1-ethylimidazol-2-yl)sulfanyl-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 55508324) has the molecular formula C18H21F3N4OS and a molecular weight of 398.45 g/mol. Its IUPAC name is 2-(1-ethylimidazol-2-yl)sulfanyl-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(1-ethylimidazol-2-yl)sulfanyl-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55508324 |
| Molecular Formula | C18H21F3N4OS |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-(1-ethylimidazol-2-yl)sulfanyl-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | CCn1ccnc1SCC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H21F3N4OS/c1-2-23-7-6-22-17(23)27-13-16(26)25-10-8-24(9-11-25)15-5-3-4-14(12-15)18(19,20)21/h3-7,12H,2,8-11,13H2,1H3 |
| InChIKey | LMHWHKNYWDCLFC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |