C24H27F3N2O4 — CID 55740540
4-(4-acetyl-2-methoxyphenoxy)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one (PubChem CID 55740540) has the molecular formula C24H27F3N2O4 and a molecular weight of 464.48 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 55740540 |
| Molecular Formula | C24H27F3N2O4 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butan-1-one |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H27F3N2O4/c1-17(30)18-8-9-21(22(15-18)32-2)33-14-4-7-23(31)29-12-10-28(11-13-29)20-6-3-5-19(16-20)24(25,26)27/h3,5-6,8-9,15-16H,4,7,10-14H2,1-2H3 |
| InChIKey | WQKQYFMUQJHGCQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|