C22H23F3N2O5 — CID 34376747
[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2-(2-methoxyphenoxy)acetate (PubChem CID 34376747) has the molecular formula C22H23F3N2O5 and a molecular weight of 452.43 g/mol. Its IUPAC name is [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 34376747 |
| Molecular Formula | C22H23F3N2O5 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)OCC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H23F3N2O5/c1-30-18-7-2-3-8-19(18)31-15-21(29)32-14-20(28)27-11-9-26(10-12-27)17-6-4-5-16(13-17)22(23,24)25/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | GURXEMFRKYYHOR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |