C25H30FNO4 — CID 60521078
4-(4-acetyl-2-methoxyphenoxy)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]butan-1-one (PubChem CID 60521078) has the molecular formula C25H30FNO4 and a molecular weight of 427.52 g/mol. Its IUPAC name is 4-(4-acetyl-2-methoxyphenoxy)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]butan-1-one.
| Compound Name | 4-(4-acetyl-2-methoxyphenoxy)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 60521078 |
| Molecular Formula | C25H30FNO4 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | 4-(4-acetyl-2-methoxyphenoxy)-1-[4-[(3-fluorophenyl)methyl]piperidin-1-yl]butan-1-one |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)N1CCC(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C25H30FNO4/c1-18(28)21-8-9-23(24(17-21)30-2)31-14-4-7-25(29)27-12-10-19(11-13-27)15-20-5-3-6-22(26)16-20/h3,5-6,8-9,16-17,19H,4,7,10-15H2,1-2H3 |
| InChIKey | SZZVTLOAZWZUQU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|