C21H23FN2O6S — CID 27972483
2-(4-acetyl-2-methoxyphenoxy)-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 27972483) has the molecular formula C21H23FN2O6S and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-(4-acetyl-2-methoxyphenoxy)-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(4-acetyl-2-methoxyphenoxy)-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 27972483 |
| Molecular Formula | C21H23FN2O6S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 2-(4-acetyl-2-methoxyphenoxy)-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCC(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H23FN2O6S/c1-15(25)16-6-7-19(20(12-16)29-2)30-14-21(26)23-8-10-24(11-9-23)31(27,28)18-5-3-4-17(22)13-18/h3-7,12-13H,8-11,14H2,1-2H3 |
| InChIKey | DIZNPMGBMBPQJA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |