C20H20F3N3O3 — CID 175584788
[2-oxo-1-phenyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] carbamate (PubChem CID 175584788) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is [2-oxo-1-phenyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] carbamate.
| Compound Name | [2-oxo-1-phenyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] carbamate |
|---|---|
| PubChem CID | 175584788 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [2-oxo-1-phenyl-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] carbamate |
| SMILES | NC(=O)OC(C(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H20F3N3O3/c21-20(22,23)15-7-4-8-16(13-15)25-9-11-26(12-10-25)18(27)17(29-19(24)28)14-5-2-1-3-6-14/h1-8,13,17H,9-12H2,(H2,24,28) |
| InChIKey | MTHHZPRQEKAUHP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |