C24H21B3F3N3O3 — CID 168899591
CID 168899591 (PubChem CID 168899591) has the molecular formula C24H21B3F3N3O3 and a molecular weight of 488.88 g/mol.
| Compound Name | CID 168899591 |
|---|---|
| PubChem CID | 168899591 |
| Molecular Formula | C24H21B3F3N3O3 |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | — |
| SMILES | [B]C1([B])C(=O)N(C(C(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)c2ccccc2)C(=O)C1([B])C |
| InChI | InChI=1S/C24H21B3F3N3O3/c1-22(25)20(35)33(21(36)23(22,26)27)18(15-6-3-2-4-7-15)19(34)32-12-10-31(11-13-32)17-9-5-8-16(14-17)24(28,29)30/h2-9,14,18H,10-13H2,1H3 |
| InChIKey | GDTBGIQYCWCTPK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|