C13H20N4O2S — CID 119578761
[3-(3-methylpiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]urea (PubChem CID 119578761) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is [3-(3-methylpiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]urea.
| Compound Name | [3-(3-methylpiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]urea |
|---|---|
| PubChem CID | 119578761 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [3-(3-methylpiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]urea |
| SMILES | CC1CN(C(=O)CC(NC(N)=O)c2cccs2)CCN1 |
| InChI | InChI=1S/C13H20N4O2S/c1-9-8-17(5-4-15-9)12(18)7-10(16-13(14)19)11-3-2-6-20-11/h2-3,6,9-10,15H,4-5,7-8H2,1H3,(H3,14,16,19) |
| InChIKey | USFQOAOHIMQUGU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |