C13H17N3O4S — CID 125118766
(2R)-1-[(3S)-3-(carbamoylamino)-3-thiophen-2-ylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 125118766) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is (2R)-1-[(3S)-3-(carbamoylamino)-3-thiophen-2-ylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[(3S)-3-(carbamoylamino)-3-thiophen-2-ylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 125118766 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (2R)-1-[(3S)-3-(carbamoylamino)-3-thiophen-2-ylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NC(=O)N[C@@H](CC(=O)N1CCC[C@@H]1C(=O)O)c1cccs1 |
| InChI | InChI=1S/C13H17N3O4S/c14-13(20)15-8(10-4-2-6-21-10)7-11(17)16-5-1-3-9(16)12(18)19/h2,4,6,8-9H,1,3,5,7H2,(H,18,19)(H3,14,15,20)/t8-,9+/m0/s1 |
| InChIKey | ZDKLOJWPMLHUDO-DTWKUNHWSA-N |
| XLogP | 0.92 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |