C13H21ClN4O2S — CID 119471960
[3-(2-methylpiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]urea;hydrochloride (PubChem CID 119471960) has the molecular formula C13H21ClN4O2S and a molecular weight of 332.86 g/mol. Its IUPAC name is [3-(2-methylpiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]urea;hydrochloride.
| Compound Name | [3-(2-methylpiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]urea;hydrochloride |
|---|---|
| PubChem CID | 119471960 |
| Molecular Formula | C13H21ClN4O2S |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | [3-(2-methylpiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]urea;hydrochloride |
| SMILES | CC1CNCCN1C(=O)CC(NC(N)=O)c1cccs1.Cl |
| InChI | InChI=1S/C13H20N4O2S.ClH/c1-9-8-15-4-5-17(9)12(18)7-10(16-13(14)19)11-3-2-6-20-11;/h2-3,6,9-10,15H,4-5,7-8H2,1H3,(H3,14,16,19);1H |
| InChIKey | LQMFBTHPVJFKNZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |