C14H19N3O3S — CID 63079022
N-[3-(2-methyl-3-oxopiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]acetamide (PubChem CID 63079022) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[3-(2-methyl-3-oxopiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]acetamide.
| Compound Name | N-[3-(2-methyl-3-oxopiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]acetamide |
|---|---|
| PubChem CID | 63079022 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[3-(2-methyl-3-oxopiperazin-1-yl)-3-oxo-1-thiophen-2-ylpropyl]acetamide |
| SMILES | CC(=O)NC(CC(=O)N1CCNC(=O)C1C)c1cccs1 |
| InChI | InChI=1S/C14H19N3O3S/c1-9-14(20)15-5-6-17(9)13(19)8-11(16-10(2)18)12-4-3-7-21-12/h3-4,7,9,11H,5-6,8H2,1-2H3,(H,15,20)(H,16,18) |
| InChIKey | RZSKMCALWXEQTM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |