C14H17ClF2N2O4S — CID 75456902
4-chloro-N-(2,2-difluoroethoxy)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 75456902) has the molecular formula C14H17ClF2N2O4S and a molecular weight of 382.82 g/mol. Its IUPAC name is 4-chloro-N-(2,2-difluoroethoxy)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(2,2-difluoroethoxy)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 75456902 |
| Molecular Formula | C14H17ClF2N2O4S |
| Molecular Weight | 382.82 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4-chloro-N-(2,2-difluoroethoxy)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NOCC(F)F)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C14H17ClF2N2O4S/c15-11-5-4-10(14(20)18-23-9-13(16)17)8-12(11)24(21,22)19-6-2-1-3-7-19/h4-5,8,13H,1-3,6-7,9H2,(H,18,20) |
| InChIKey | ILQFOASDIHOQFH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.82 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|